C21H25N5O3 — CID 4266683
3-(1-methylpyrrol-2-yl)-1-(4-nitrophenyl)-N,N-dipropylpyrazole-5-carboxamide (PubChem CID 4266683) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-(1-methylpyrrol-2-yl)-1-(4-nitrophenyl)-N,N-dipropylpyrazole-5-carboxamide.
| Compound Name | 3-(1-methylpyrrol-2-yl)-1-(4-nitrophenyl)-N,N-dipropylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4266683 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 3-(1-methylpyrrol-2-yl)-1-(4-nitrophenyl)-N,N-dipropylpyrazole-5-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(-c2cccn2C)nn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H25N5O3/c1-4-12-24(13-5-2)21(27)20-15-18(19-7-6-14-23(19)3)22-25(20)16-8-10-17(11-9-16)26(28)29/h6-11,14-15H,4-5,12-13H2,1-3H3 |
| InChIKey | GCAFCUSUXUJCCV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|