C32H29N3O2 — CID 3434474
N-benzyl-1-(4-methoxyphenyl)-3-phenyl-N-(2-phenylethyl)pyrazole-5-carboxamide (PubChem CID 3434474) has the molecular formula C32H29N3O2 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-benzyl-1-(4-methoxyphenyl)-3-phenyl-N-(2-phenylethyl)pyrazole-5-carboxamide.
| Compound Name | N-benzyl-1-(4-methoxyphenyl)-3-phenyl-N-(2-phenylethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3434474 |
| Molecular Formula | C32H29N3O2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N-benzyl-1-(4-methoxyphenyl)-3-phenyl-N-(2-phenylethyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-n2nc(-c3ccccc3)cc2C(=O)N(CCc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H29N3O2/c1-37-29-19-17-28(18-20-29)35-31(23-30(33-35)27-15-9-4-10-16-27)32(36)34(24-26-13-7-3-8-14-26)22-21-25-11-5-2-6-12-25/h2-20,23H,21-22,24H2,1H3 |
| InChIKey | KIWLLOUQENJHDR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |