C22H20N4O2S2 — CID 56519901
2-(2-methoxyphenyl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 56519901) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-methoxyphenyl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 56519901 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-(2-methoxyphenyl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccccc1-c1nc(C(=O)NCCCc2nc(-c3ccncc3)cs2)cs1 |
| InChI | InChI=1S/C22H20N4O2S2/c1-28-19-6-3-2-5-16(19)22-26-18(14-30-22)21(27)24-10-4-7-20-25-17(13-29-20)15-8-11-23-12-9-15/h2-3,5-6,8-9,11-14H,4,7,10H2,1H3,(H,24,27) |
| InChIKey | HJVRVDMORVMXLV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|