C21H17FN4OS2 — CID 56518615
2-(2-fluorophenyl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-5-carboxamide (PubChem CID 56518615) has the molecular formula C21H17FN4OS2 and a molecular weight of 424.53 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2-fluorophenyl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 56518615 |
| Molecular Formula | C21H17FN4OS2 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCCc1nc(-c2ccncc2)cs1)c1cnc(-c2ccccc2F)s1 |
| InChI | InChI=1S/C21H17FN4OS2/c22-16-5-2-1-4-15(16)21-25-12-18(29-21)20(27)24-9-3-6-19-26-17(13-28-19)14-7-10-23-11-8-14/h1-2,4-5,7-8,10-13H,3,6,9H2,(H,24,27) |
| InChIKey | YWKIADGUCAORMI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|