C25H21N5OS — CID 56518872
4-(benzimidazol-1-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]benzamide (PubChem CID 56518872) has the molecular formula C25H21N5OS and a molecular weight of 439.54 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]benzamide.
| Compound Name | 4-(benzimidazol-1-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]benzamide |
|---|---|
| PubChem CID | 56518872 |
| Molecular Formula | C25H21N5OS |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 4-(benzimidazol-1-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]benzamide |
| SMILES | O=C(NCCCc1nc(-c2ccncc2)cs1)c1ccc(-n2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C25H21N5OS/c31-25(27-13-3-6-24-29-22(16-32-24)18-11-14-26-15-12-18)19-7-9-20(10-8-19)30-17-28-21-4-1-2-5-23(21)30/h1-2,4-5,7-12,14-17H,3,6,13H2,(H,27,31) |
| InChIKey | NHGZEHZYWQKKMX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|