C22H22N4O2S — CID 56520293
1-acetyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-2,3-dihydroindole-5-carboxamide (PubChem CID 56520293) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 1-acetyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-acetyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 56520293 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-acetyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-2,3-dihydroindole-5-carboxamide |
| SMILES | CC(=O)N1CCc2cc(C(=O)NCCCc3nc(-c4ccncc4)cs3)ccc21 |
| InChI | InChI=1S/C22H22N4O2S/c1-15(27)26-12-8-17-13-18(4-5-20(17)26)22(28)24-9-2-3-21-25-19(14-29-21)16-6-10-23-11-7-16/h4-7,10-11,13-14H,2-3,8-9,12H2,1H3,(H,24,28) |
| InChIKey | SEPGINSMMBMGBW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|