C18H26N2O3S — CID 119755174
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(benzenesulfonyl)propyl]acetamide (PubChem CID 119755174) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(benzenesulfonyl)propyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(benzenesulfonyl)propyl]acetamide |
|---|---|
| PubChem CID | 119755174 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(benzenesulfonyl)propyl]acetamide |
| SMILES | O=C(CC1CC2CCC(C1)N2)NCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O3S/c21-18(13-14-11-15-7-8-16(12-14)20-15)19-9-4-10-24(22,23)17-5-2-1-3-6-17/h1-3,5-6,14-16,20H,4,7-13H2,(H,19,21) |
| InChIKey | ZNEJZHBMQJTWSU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|