C17H23ClN2O3S — CID 119725578
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(4-chlorophenyl)sulfonylethyl]acetamide (PubChem CID 119725578) has the molecular formula C17H23ClN2O3S and a molecular weight of 370.90 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(4-chlorophenyl)sulfonylethyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(4-chlorophenyl)sulfonylethyl]acetamide |
|---|---|
| PubChem CID | 119725578 |
| Molecular Formula | C17H23ClN2O3S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(4-chlorophenyl)sulfonylethyl]acetamide |
| SMILES | O=C(CC1CC2CCC(C1)N2)NCCS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN2O3S/c18-13-1-5-16(6-2-13)24(22,23)8-7-19-17(21)11-12-9-14-3-4-15(10-12)20-14/h1-2,5-6,12,14-15,20H,3-4,7-11H2,(H,19,21) |
| InChIKey | XOUCKKFIJDXJMX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |