C15H16N2O4 — CID 97082127
N-[(2R)-1-amino-3-methoxy-1-oxopropan-2-yl]-3-(furan-3-yl)benzamide (PubChem CID 97082127) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is N-[(2R)-1-amino-3-methoxy-1-oxopropan-2-yl]-3-(furan-3-yl)benzamide.
| Compound Name | N-[(2R)-1-amino-3-methoxy-1-oxopropan-2-yl]-3-(furan-3-yl)benzamide |
|---|---|
| PubChem CID | 97082127 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[(2R)-1-amino-3-methoxy-1-oxopropan-2-yl]-3-(furan-3-yl)benzamide |
| SMILES | COC[C@@H](NC(=O)c1cccc(-c2ccoc2)c1)C(N)=O |
| InChI | InChI=1S/C15H16N2O4/c1-20-9-13(14(16)18)17-15(19)11-4-2-3-10(7-11)12-5-6-21-8-12/h2-8,13H,9H2,1H3,(H2,16,18)(H,17,19)/t13-/m1/s1 |
| InChIKey | YXHQUEMUDCMRSZ-CYBMUJFWSA-N |
| XLogP | 1.18 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |