About 2-benzamidoethyl 1-benzofuran-2-carboxylate
2-benzamidoethyl 1-benzofuran-2-carboxylate (PubChem CID 569920) has the molecular formula C18H15NO4
and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-benzamidoethyl 1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | 2-benzamidoethyl 1-benzofuran-2-carboxylate |
| PubChem CID | 569920 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-benzamidoethyl 1-benzofuran-2-carboxylate |
| SMILES | O=C(NCCOC(=O)c1cc2ccccc2o1)c1ccccc1 |
| InChI | InChI=1S/C18H15NO4/c20-17(13-6-2-1-3-7-13)19-10-11-22-18(21)16-12-14-8-4-5-9-15(14)23-16/h1-9,12H,10-11H2,(H,19,20) |
| InChIKey | VBHBZHJOGYCYCR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-benzamidoethyl 1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamidoethyl 1-benzofuran-2-carboxylate?
The IUPAC name of 2-benzamidoethyl 1-benzofuran-2-carboxylate (CID 569920) is 2-benzamidoethyl 1-benzofuran-2-carboxylate.
What is the SMILES notation for 2-benzamidoethyl 1-benzofuran-2-carboxylate?
The canonical SMILES for 2-benzamidoethyl 1-benzofuran-2-carboxylate is O=C(NCCOC(=O)c1cc2ccccc2o1)c1ccccc1.
What is the InChIKey of 2-benzamidoethyl 1-benzofuran-2-carboxylate?
The InChIKey is VBHBZHJOGYCYCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO4/c20-17(13-6-2-1-3-7-13)19-10-11-22-18(21)16-12-14-8-4-5-9-15(14)23-16/h1-9,12H,10-11H2,(H,19,20).
What are the key properties of 2-benzamidoethyl 1-benzofuran-2-carboxylate?
2-benzamidoethyl 1-benzofuran-2-carboxylate has a molecular weight of 309.32 g/mol, XLogP of 3.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamidoethyl 1-benzofuran-2-carboxylate is sourced from PubChem (CID 569920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).