C32H37N2O6P — CID 90139564
2-[[4-[1-[4-(1-benzofuran-2-yl)anilino]-1-oxooctan-2-yl]oxybenzoyl]amino]ethyl-methylphosphinic acid (PubChem CID 90139564) has the molecular formula C32H37N2O6P and a molecular weight of 576.63 g/mol. Its IUPAC name is 2-[[4-[1-[4-(1-benzofuran-2-yl)anilino]-1-oxooctan-2-yl]oxybenzoyl]amino]ethyl-methylphosphinic acid.
| Compound Name | 2-[[4-[1-[4-(1-benzofuran-2-yl)anilino]-1-oxooctan-2-yl]oxybenzoyl]amino]ethyl-methylphosphinic acid |
|---|---|
| PubChem CID | 90139564 |
| Molecular Formula | C32H37N2O6P |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 2-[[4-[1-[4-(1-benzofuran-2-yl)anilino]-1-oxooctan-2-yl]oxybenzoyl]amino]ethyl-methylphosphinic acid |
| SMILES | CCCCCCC(Oc1ccc(C(=O)NCCP(C)(=O)O)cc1)C(=O)Nc1ccc(-c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C32H37N2O6P/c1-3-4-5-6-11-29(39-27-18-14-24(15-19-27)31(35)33-20-21-41(2,37)38)32(36)34-26-16-12-23(13-17-26)30-22-25-9-7-8-10-28(25)40-30/h7-10,12-19,22,29H,3-6,11,20-21H2,1-2H3,(H,33,35)(H,34,36)(H,37,38) |
| InChIKey | VYWKZZQSSPATQT-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|