C18H18NO6P — CID 102130870
2-[[2-(4-methoxyphenyl)-1-benzofuran-5-carbonyl]amino]ethylphosphonic acid (PubChem CID 102130870) has the molecular formula C18H18NO6P and a molecular weight of 375.32 g/mol. Its IUPAC name is 2-[[2-(4-methoxyphenyl)-1-benzofuran-5-carbonyl]amino]ethylphosphonic acid.
| Compound Name | 2-[[2-(4-methoxyphenyl)-1-benzofuran-5-carbonyl]amino]ethylphosphonic acid |
|---|---|
| PubChem CID | 102130870 |
| Molecular Formula | C18H18NO6P |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[[2-(4-methoxyphenyl)-1-benzofuran-5-carbonyl]amino]ethylphosphonic acid |
| SMILES | COc1ccc(-c2cc3cc(C(=O)NCCP(=O)(O)O)ccc3o2)cc1 |
| InChI | InChI=1S/C18H18NO6P/c1-24-15-5-2-12(3-6-15)17-11-14-10-13(4-7-16(14)25-17)18(20)19-8-9-26(21,22)23/h2-7,10-11H,8-9H2,1H3,(H,19,20)(H2,21,22,23) |
| InChIKey | AXIRAXKDQLMKTM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|