C24H25N3O6 — CID 59901661
4-(1-benzofuran-2-yl)-N-[(2S)-5-(hydroxyamino)-1-morpholin-4-yl-1,5-dioxopentan-2-yl]benzamide (PubChem CID 59901661) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-N-[(2S)-5-(hydroxyamino)-1-morpholin-4-yl-1,5-dioxopentan-2-yl]benzamide.
| Compound Name | 4-(1-benzofuran-2-yl)-N-[(2S)-5-(hydroxyamino)-1-morpholin-4-yl-1,5-dioxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 59901661 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-N-[(2S)-5-(hydroxyamino)-1-morpholin-4-yl-1,5-dioxopentan-2-yl]benzamide |
| SMILES | O=C(CC[C@H](NC(=O)c1ccc(-c2cc3ccccc3o2)cc1)C(=O)N1CCOCC1)NO |
| InChI | InChI=1S/C24H25N3O6/c28-22(26-31)10-9-19(24(30)27-11-13-32-14-12-27)25-23(29)17-7-5-16(6-8-17)21-15-18-3-1-2-4-20(18)33-21/h1-8,15,19,31H,9-14H2,(H,25,29)(H,26,28)/t19-/m0/s1 |
| InChIKey | MOEHZBQLMAUOLD-IBGZPJMESA-N |
| XLogP | 2.34 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|