C27H27N3O3 — CID 42911722
2-[4-(1-benzofuran-2-yl)anilino]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 42911722) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[4-(1-benzofuran-2-yl)anilino]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 2-[4-(1-benzofuran-2-yl)anilino]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 42911722 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 2-[4-(1-benzofuran-2-yl)anilino]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | CC(Nc1ccc(-c2cc3ccccc3o2)cc1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H27N3O3/c1-19(27(31)29-23-10-12-24(13-11-23)30-14-16-32-17-15-30)28-22-8-6-20(7-9-22)26-18-21-4-2-3-5-25(21)33-26/h2-13,18-19,28H,14-17H2,1H3,(H,29,31) |
| InChIKey | KDWFEDCUIFBJAE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|