C28H20ClF3N2O4S — CID 67483398
3-[[4-[2-(4-chlorophenyl)-2-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]ethenyl]benzoyl]amino]propanoic acid (PubChem CID 67483398) has the molecular formula C28H20ClF3N2O4S and a molecular weight of 572.99 g/mol. Its IUPAC name is 3-[[4-[2-(4-chlorophenyl)-2-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]ethenyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[2-(4-chlorophenyl)-2-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]ethenyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67483398 |
| Molecular Formula | C28H20ClF3N2O4S |
| Molecular Weight | 572.99 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | 3-[[4-[2-(4-chlorophenyl)-2-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]ethenyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(C=C(c2ccc(Cl)cc2)c2nc(-c3ccc(OC(F)(F)F)cc3)cs2)cc1 |
| InChI | InChI=1S/C28H20ClF3N2O4S/c29-21-9-5-18(6-10-21)23(15-17-1-3-20(4-2-17)26(37)33-14-13-25(35)36)27-34-24(16-39-27)19-7-11-22(12-8-19)38-28(30,31)32/h1-12,15-16H,13-14H2,(H,33,37)(H,35,36) |
| InChIKey | QQAJIWMYORUOEL-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.99 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|