C38H41N3O6S — CID 20742280
3-[[4-[2-(4-cyclohexylphenyl)-3-[3-[methyl(phenyl)sulfamoyl]anilino]-3-oxopropyl]benzoyl]amino]propanoic acid (PubChem CID 20742280) has the molecular formula C38H41N3O6S and a molecular weight of 667.83 g/mol. Its IUPAC name is 3-[[4-[2-(4-cyclohexylphenyl)-3-[3-[methyl(phenyl)sulfamoyl]anilino]-3-oxopropyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[2-(4-cyclohexylphenyl)-3-[3-[methyl(phenyl)sulfamoyl]anilino]-3-oxopropyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20742280 |
| Molecular Formula | C38H41N3O6S |
| Molecular Weight | 667.83 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | 3-[[4-[2-(4-cyclohexylphenyl)-3-[3-[methyl(phenyl)sulfamoyl]anilino]-3-oxopropyl]benzoyl]amino]propanoic acid |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(NC(=O)C(Cc2ccc(C(=O)NCCC(=O)O)cc2)c2ccc(C3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C38H41N3O6S/c1-41(33-12-6-3-7-13-33)48(46,47)34-14-8-11-32(26-34)40-38(45)35(30-21-19-29(20-22-30)28-9-4-2-5-10-28)25-27-15-17-31(18-16-27)37(44)39-24-23-36(42)43/h3,6-8,11-22,26,28,35H,2,4-5,9-10,23-25H2,1H3,(H,39,44)(H,40,45)(H,42,43) |
| InChIKey | WTCVGUJPJLRGHS-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.83 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |