C18H29NO3 — CID 124859287
[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-carbamoylcyclohexane-1-carboxylate (PubChem CID 124859287) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is [(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-carbamoylcyclohexane-1-carboxylate.
| Compound Name | [(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-carbamoylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 124859287 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | [(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-carbamoylcyclohexane-1-carboxylate |
| SMILES | C[C@H]1[C@H]2C[C@H](C[C@H]1OC(=O)C1CCC(C(N)=O)CC1)C2(C)C |
| InChI | InChI=1S/C18H29NO3/c1-10-14-8-13(18(14,2)3)9-15(10)22-17(21)12-6-4-11(5-7-12)16(19)20/h10-15H,4-9H2,1-3H3,(H2,19,20)/t10-,11?,12?,13+,14+,15+/m0/s1 |
| InChIKey | XNOUHVRGVWZJNS-QWFQKCJJSA-N |
| XLogP | 2.89 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |