C11H21N — CID 99644516
(1S,2S,3S,5R)-N,2,6,6-tetramethylbicyclo[3.1.1]heptan-3-amine (PubChem CID 99644516) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (1S,2S,3S,5R)-N,2,6,6-tetramethylbicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1S,2S,3S,5R)-N,2,6,6-tetramethylbicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 99644516 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (1S,2S,3S,5R)-N,2,6,6-tetramethylbicyclo[3.1.1]heptan-3-amine |
| SMILES | CN[C@H]1C[C@H]2C[C@@H]([C@@H]1C)C2(C)C |
| InChI | InChI=1S/C11H21N/c1-7-9-5-8(11(9,2)3)6-10(7)12-4/h7-10,12H,5-6H2,1-4H3/t7-,8+,9-,10-/m0/s1 |
| InChIKey | KUNCCMAQTBTWDW-JXUBOQSCSA-N |
| XLogP | 2.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |