C21H36 — CID 158391246
(1R,5R)-2,6,6-trimethyl-3-[[(1R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]methyl]bicyclo[3.1.1]heptane (PubChem CID 158391246) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is (1R,5R)-2,6,6-trimethyl-3-[[(1R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]methyl]bicyclo[3.1.1]heptane.
| Compound Name | (1R,5R)-2,6,6-trimethyl-3-[[(1R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]methyl]bicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 158391246 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | (1R,5R)-2,6,6-trimethyl-3-[[(1R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]methyl]bicyclo[3.1.1]heptane |
| SMILES | CC1C(CC2C[C@@H]3C[C@H](C2C)C3(C)C)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C21H36/c1-12-14(8-16-10-18(12)20(16,3)4)7-15-9-17-11-19(13(15)2)21(17,5)6/h12-19H,7-11H2,1-6H3/t12?,13?,14?,15?,16-,17-,18-,19-/m1/s1 |
| InChIKey | ZOGXPPJJIRKCLZ-AYTQWWJXSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |