C14H26O3S — CID 159281665
4-[(1R,3R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]butane-1-sulfonic acid (PubChem CID 159281665) has the molecular formula C14H26O3S and a molecular weight of 274.43 g/mol. Its IUPAC name is 4-[(1R,3R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]butane-1-sulfonic acid.
| Compound Name | 4-[(1R,3R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 159281665 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 4-[(1R,3R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]butane-1-sulfonic acid |
| SMILES | CC1[C@H](CCCCS(=O)(=O)O)CC2C[C@H]1C2(C)C |
| InChI | InChI=1S/C14H26O3S/c1-10-11(6-4-5-7-18(15,16)17)8-12-9-13(10)14(12,2)3/h10-13H,4-9H2,1-3H3,(H,15,16,17)/t10?,11-,12?,13-/m1/s1 |
| InChIKey | WUABSSOVHHBDAQ-POOIEITISA-N |
| XLogP | 3.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|