C13H26O3S — CID 58052678
4-(3,3,5-trimethylcyclohexyl)butane-1-sulfonic acid (PubChem CID 58052678) has the molecular formula C13H26O3S and a molecular weight of 262.41 g/mol. Its IUPAC name is 4-(3,3,5-trimethylcyclohexyl)butane-1-sulfonic acid.
| Compound Name | 4-(3,3,5-trimethylcyclohexyl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58052678 |
| Molecular Formula | C13H26O3S |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 4-(3,3,5-trimethylcyclohexyl)butane-1-sulfonic acid |
| SMILES | CC1CC(CCCCS(=O)(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C13H26O3S/c1-11-8-12(10-13(2,3)9-11)6-4-5-7-17(14,15)16/h11-12H,4-10H2,1-3H3,(H,14,15,16) |
| InChIKey | BONMSZGLBGVQIP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|