C9H21NO7S2 — CID 140563285
hydrogen sulfate;4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid (PubChem CID 140563285) has the molecular formula C9H21NO7S2 and a molecular weight of 319.40 g/mol. Its IUPAC name is hydrogen sulfate;4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid.
| Compound Name | hydrogen sulfate;4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 140563285 |
| Molecular Formula | C9H21NO7S2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | hydrogen sulfate;4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid |
| SMILES | C[NH+]1CCC(CCCCS(=O)(=O)O)C1.O=S(=O)([O-])O |
| InChI | InChI=1S/C9H19NO3S.H2O4S/c1-10-6-5-9(8-10)4-2-3-7-14(11,12)13;1-5(2,3)4/h9H,2-8H2,1H3,(H,11,12,13);(H2,1,2,3,4) |
| InChIKey | YTPSAWDDCNRZSB-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|