C10H23NO3S — CID 171570862
methanesulfonate;1-methyl-3-propylpiperidin-1-ium (PubChem CID 171570862) has the molecular formula C10H23NO3S and a molecular weight of 237.36 g/mol. Its IUPAC name is methanesulfonate;1-methyl-3-propylpiperidin-1-ium.
| Compound Name | methanesulfonate;1-methyl-3-propylpiperidin-1-ium |
|---|---|
| PubChem CID | 171570862 |
| Molecular Formula | C10H23NO3S |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | methanesulfonate;1-methyl-3-propylpiperidin-1-ium |
| SMILES | CCCC1CCC[NH+](C)C1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H19N.CH4O3S/c1-3-5-9-6-4-7-10(2)8-9;1-5(2,3)4/h9H,3-8H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | GEGDNPATZSVURZ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|