C13H29NO3S — CID 171571517
1-heptyl-2-methylpyrrolidin-1-ium;methanesulfonate (PubChem CID 171571517) has the molecular formula C13H29NO3S and a molecular weight of 279.45 g/mol. Its IUPAC name is 1-heptyl-2-methylpyrrolidin-1-ium;methanesulfonate.
| Compound Name | 1-heptyl-2-methylpyrrolidin-1-ium;methanesulfonate |
|---|---|
| PubChem CID | 171571517 |
| Molecular Formula | C13H29NO3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 1-heptyl-2-methylpyrrolidin-1-ium;methanesulfonate |
| SMILES | CCCCCCC[NH+]1CCCC1C.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H25N.CH4O3S/c1-3-4-5-6-7-10-13-11-8-9-12(13)2;1-5(2,3)4/h12H,3-11H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | NLCDEHNOBRQRQN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|