C9H18F3NO6S2 — CID 87060020
3-(1-methylpyrrolidin-1-ium-3-yl)propane-1-sulfonic acid;trifluoromethanesulfonate (PubChem CID 87060020) has the molecular formula C9H18F3NO6S2 and a molecular weight of 357.37 g/mol. Its IUPAC name is 3-(1-methylpyrrolidin-1-ium-3-yl)propane-1-sulfonic acid;trifluoromethanesulfonate.
| Compound Name | 3-(1-methylpyrrolidin-1-ium-3-yl)propane-1-sulfonic acid;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87060020 |
| Molecular Formula | C9H18F3NO6S2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 3-(1-methylpyrrolidin-1-ium-3-yl)propane-1-sulfonic acid;trifluoromethanesulfonate |
| SMILES | C[NH+]1CCC(CCCS(=O)(=O)O)C1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C8H17NO3S.CHF3O3S/c1-9-5-4-8(7-9)3-2-6-13(10,11)12;2-1(3,4)8(5,6)7/h8H,2-7H2,1H3,(H,10,11,12);(H,5,6,7) |
| InChIKey | JOVGOQMXXVHSGE-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|