C12H23B — CID 162405466
dimethyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 162405466) has the molecular formula C12H23B and a molecular weight of 178.13 g/mol. Its IUPAC name is dimethyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | dimethyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 162405466 |
| Molecular Formula | C12H23B |
| Molecular Weight | 178.13 g/mol |
| Exact Mass | 178.19 |
| IUPAC Name | dimethyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | CB(C)[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C |
| InChI | InChI=1S/C12H23B/c1-8-10-6-9(12(10,2)3)7-11(8)13(4)5/h8-11H,6-7H2,1-5H3/t8-,9+,10-,11-/m1/s1 |
| InChIKey | MOTQEJNKTDWMEE-LMLFDSFASA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.13 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|