C21H37B — CID 10935472
methyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-[(1S,2R,4S,5R)-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]borane (PubChem CID 10935472) has the molecular formula C21H37B and a molecular weight of 300.34 g/mol. Its IUPAC name is methyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-[(1S,2R,4S,5R)-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | methyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-[(1S,2R,4S,5R)-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 10935472 |
| Molecular Formula | C21H37B |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.30 |
| IUPAC Name | methyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-[(1S,2R,4S,5R)-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]borane |
| SMILES | CB([C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C)[C@@H]1C[C@H](C)[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C21H37B/c1-12-8-19(17-11-15(12)21(17,5)6)22(7)18-10-14-9-16(13(18)2)20(14,3)4/h12-19H,8-11H2,1-7H3/t12-,13+,14-,15+,16+,17-,18+,19+/m0/s1 |
| InChIKey | VSYOVNJUILRGDQ-CHDJAYLVSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|