C25H45B — CID 135048539
3-methylbutan-2-yl-bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 135048539) has the molecular formula C25H45B and a molecular weight of 356.45 g/mol. Its IUPAC name is 3-methylbutan-2-yl-bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | 3-methylbutan-2-yl-bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 135048539 |
| Molecular Formula | C25H45B |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.36 |
| IUPAC Name | 3-methylbutan-2-yl-bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | CC(C)C(C)B([C@H]1C[C@H]2C[C@@H]([C@@H]1C)C2(C)C)[C@H]1C[C@H]2C[C@@H]([C@@H]1C)C2(C)C |
| InChI | InChI=1S/C25H45B/c1-14(2)17(5)26(22-12-18-10-20(15(22)3)24(18,6)7)23-13-19-11-21(16(23)4)25(19,8)9/h14-23H,10-13H2,1-9H3/t15-,16-,17?,18+,19+,20-,21-,22-,23-/m0/s1 |
| InChIKey | OKARWFJRQDFANG-WGIFWAJFSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|