C23H37B — CID 123940656
propa-1,2-dienyl-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane (PubChem CID 123940656) has the molecular formula C23H37B and a molecular weight of 324.36 g/mol. Its IUPAC name is propa-1,2-dienyl-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane.
| Compound Name | propa-1,2-dienyl-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane |
|---|---|
| PubChem CID | 123940656 |
| Molecular Formula | C23H37B |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | propa-1,2-dienyl-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane |
| SMILES | C=C=CB(C1CC2CC(C1C)C2(C)C)C1CC2CC(C1C)C2(C)C |
| InChI | InChI=1S/C23H37B/c1-8-9-24(20-12-16-10-18(14(20)2)22(16,4)5)21-13-17-11-19(15(21)3)23(17,6)7/h9,14-21H,1,10-13H2,2-7H3 |
| InChIKey | VMEXZHBVGHPASD-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|