C24H47B — CID 134906549
hexyl-octyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 134906549) has the molecular formula C24H47B and a molecular weight of 346.45 g/mol. Its IUPAC name is hexyl-octyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | hexyl-octyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 134906549 |
| Molecular Formula | C24H47B |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.38 |
| IUPAC Name | hexyl-octyl-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | CCCCCCCCB(CCCCCC)[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C |
| InChI | InChI=1S/C24H47B/c1-6-8-10-12-13-15-17-25(16-14-11-9-7-2)23-19-21-18-22(20(23)3)24(21,4)5/h20-23H,6-19H2,1-5H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | SARDKHWRSMGZDI-KAOXLYBCSA-N |
| XLogP | 8.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|