C29H51BO — CID 10251886
1-[bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranyl]nonan-4-one (PubChem CID 10251886) has the molecular formula C29H51BO and a molecular weight of 426.54 g/mol. Its IUPAC name is 1-[bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranyl]nonan-4-one.
| Compound Name | 1-[bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranyl]nonan-4-one |
|---|---|
| PubChem CID | 10251886 |
| Molecular Formula | C29H51BO |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.40 |
| IUPAC Name | 1-[bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranyl]nonan-4-one |
| SMILES | CCCCCC(=O)CCCB([C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C)[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C |
| InChI | InChI=1S/C29H51BO/c1-8-9-10-12-23(31)13-11-14-30(26-17-21-15-24(19(26)2)28(21,4)5)27-18-22-16-25(20(27)3)29(22,6)7/h19-22,24-27H,8-18H2,1-7H3/t19-,20-,21+,22+,24-,25-,26-,27-/m1/s1 |
| InChIKey | WHJPCAWFDYBQAB-KTKITAIMSA-N |
| XLogP | 8.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|