C17H31BO — CID 131843452
cyclohexyl-methoxy-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 131843452) has the molecular formula C17H31BO and a molecular weight of 262.25 g/mol. Its IUPAC name is cyclohexyl-methoxy-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | cyclohexyl-methoxy-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 131843452 |
| Molecular Formula | C17H31BO |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | cyclohexyl-methoxy-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | COB(C1CCCCC1)[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C |
| InChI | InChI=1S/C17H31BO/c1-12-15-10-13(17(15,2)3)11-16(12)18(19-4)14-8-6-5-7-9-14/h12-16H,5-11H2,1-4H3/t12-,13+,15-,16-/m1/s1 |
| InChIKey | BKXWXTGKRZUPAW-OCVGTWLNSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|