C30H50BClO — CID 15259159
[(1R,2R)-2-chloro-1-cyclohexylbut-3-enoxy]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 15259159) has the molecular formula C30H50BClO and a molecular weight of 472.99 g/mol. Its IUPAC name is [(1R,2R)-2-chloro-1-cyclohexylbut-3-enoxy]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | [(1R,2R)-2-chloro-1-cyclohexylbut-3-enoxy]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 15259159 |
| Molecular Formula | C30H50BClO |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | [(1R,2R)-2-chloro-1-cyclohexylbut-3-enoxy]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | C=C[C@@H](Cl)[C@H](OB([C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C)[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C)C1CCCCC1 |
| InChI | InChI=1S/C30H50BClO/c1-8-27(32)28(20-12-10-9-11-13-20)33-31(25-16-21-14-23(18(25)2)29(21,4)5)26-17-22-15-24(19(26)3)30(22,6)7/h8,18-28H,1,9-17H2,2-7H3/t18-,19-,21+,22+,23-,24-,25-,26-,27-,28-/m1/s1 |
| InChIKey | MSGZVHAYGXEWOV-CDNMORMUSA-N |
| XLogP | 8.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|