C22H40N2 — CID 11573512
N-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-N'-[(1S,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine (PubChem CID 11573512) has the molecular formula C22H40N2 and a molecular weight of 332.58 g/mol. Its IUPAC name is N-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-N'-[(1S,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine.
| Compound Name | N-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-N'-[(1S,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 11573512 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | N-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-N'-[(1S,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine |
| SMILES | C[C@@H]1[C@H](NCCNC[C@@H]2CC[C@H]3C[C@@H]2C3(C)C)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C22H40N2/c1-14-18-11-17(22(18,4)5)12-20(14)24-9-8-23-13-15-6-7-16-10-19(15)21(16,2)3/h14-20,23-24H,6-13H2,1-5H3/t14-,15-,16-,17+,18-,19-,20+/m0/s1 |
| InChIKey | LFICFOCPXCXJCC-ADVLRGOMSA-N |
| XLogP | 4.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|