C19H27ClFNO — CID 19980605
3-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methylamino]-1-(4-fluorophenyl)propan-1-one;hydrochloride (PubChem CID 19980605) has the molecular formula C19H27ClFNO and a molecular weight of 339.88 g/mol. Its IUPAC name is 3-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methylamino]-1-(4-fluorophenyl)propan-1-one;hydrochloride.
| Compound Name | 3-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methylamino]-1-(4-fluorophenyl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 19980605 |
| Molecular Formula | C19H27ClFNO |
| Molecular Weight | 339.88 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 3-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methylamino]-1-(4-fluorophenyl)propan-1-one;hydrochloride |
| SMILES | CC1(C)C2CCC(CNCCC(=O)c3ccc(F)cc3)C1C2.Cl |
| InChI | InChI=1S/C19H26FNO.ClH/c1-19(2)15-6-3-14(17(19)11-15)12-21-10-9-18(22)13-4-7-16(20)8-5-13;/h4-5,7-8,14-15,17,21H,3,6,9-12H2,1-2H3;1H |
| InChIKey | WHWITDTWANRMCX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.88 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|