C19H28FNO — CID 19892134
3-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methylamino]-1-(4-fluorophenyl)propan-1-ol (PubChem CID 19892134) has the molecular formula C19H28FNO and a molecular weight of 305.44 g/mol. Its IUPAC name is 3-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methylamino]-1-(4-fluorophenyl)propan-1-ol.
| Compound Name | 3-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methylamino]-1-(4-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 19892134 |
| Molecular Formula | C19H28FNO |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 3-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methylamino]-1-(4-fluorophenyl)propan-1-ol |
| SMILES | CC1(C)C2CCC(CNCCC(O)c3ccc(F)cc3)C1C2 |
| InChI | InChI=1S/C19H28FNO/c1-19(2)15-6-3-14(17(19)11-15)12-21-10-9-18(22)13-4-7-16(20)8-5-13/h4-5,7-8,14-15,17-18,21-22H,3,6,9-12H2,1-2H3 |
| InChIKey | ONXZFSOSABJSMR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|