C17H22ClNO — CID 10779957
2-chloro-N-[(1R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]benzamide (PubChem CID 10779957) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is 2-chloro-N-[(1R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]benzamide.
| Compound Name | 2-chloro-N-[(1R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]benzamide |
|---|---|
| PubChem CID | 10779957 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-chloro-N-[(1R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]benzamide |
| SMILES | CC1C(NC(=O)c2ccccc2Cl)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C17H22ClNO/c1-10-13-8-11(17(13,2)3)9-15(10)19-16(20)12-6-4-5-7-14(12)18/h4-7,10-11,13,15H,8-9H2,1-3H3,(H,19,20)/t10?,11-,13+,15?/m0/s1 |
| InChIKey | PMOTVTMBNGLABI-MLSPROAXSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |