C31H36ClFN4O2 — CID 143452336
1-tert-butyl-N-[4-chloro-3-[[(1R,2R,3R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbamoyl]phenyl]-5-(4-fluorophenyl)pyrazole-4-carboxamide (PubChem CID 143452336) has the molecular formula C31H36ClFN4O2 and a molecular weight of 551.11 g/mol. Its IUPAC name is 1-tert-butyl-N-[4-chloro-3-[[(1R,2R,3R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbamoyl]phenyl]-5-(4-fluorophenyl)pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-[4-chloro-3-[[(1R,2R,3R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbamoyl]phenyl]-5-(4-fluorophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 143452336 |
| Molecular Formula | C31H36ClFN4O2 |
| Molecular Weight | 551.11 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | 1-tert-butyl-N-[4-chloro-3-[[(1R,2R,3R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbamoyl]phenyl]-5-(4-fluorophenyl)pyrazole-4-carboxamide |
| SMILES | C[C@@H]1[C@H]2CC(C[C@H]1NC(=O)c1cc(NC(=O)c3cnn(C(C)(C)C)c3-c3ccc(F)cc3)ccc1Cl)C2(C)C |
| InChI | InChI=1S/C31H36ClFN4O2/c1-17-24-13-19(31(24,5)6)14-26(17)36-28(38)22-15-21(11-12-25(22)32)35-29(39)23-16-34-37(30(2,3)4)27(23)18-7-9-20(33)10-8-18/h7-12,15-17,19,24,26H,13-14H2,1-6H3,(H,35,39)(H,36,38)/t17-,19?,24-,26-/m1/s1 |
| InChIKey | ZRCOVICBBBGNHG-DRFUWUEISA-N |
| XLogP | 7.15 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.11 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |