C28H28F6N4O — CID 143452031
1-tert-butyl-5-(4-fluorophenyl)-N-[1-(5,5,6,6,6-pentafluorohexyl)indol-6-yl]pyrazole-4-carboxamide (PubChem CID 143452031) has the molecular formula C28H28F6N4O and a molecular weight of 550.55 g/mol. Its IUPAC name is 1-tert-butyl-5-(4-fluorophenyl)-N-[1-(5,5,6,6,6-pentafluorohexyl)indol-6-yl]pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-5-(4-fluorophenyl)-N-[1-(5,5,6,6,6-pentafluorohexyl)indol-6-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 143452031 |
| Molecular Formula | C28H28F6N4O |
| Molecular Weight | 550.55 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 1-tert-butyl-5-(4-fluorophenyl)-N-[1-(5,5,6,6,6-pentafluorohexyl)indol-6-yl]pyrazole-4-carboxamide |
| SMILES | CC(C)(C)n1ncc(C(=O)Nc2ccc3ccn(CCCCC(F)(F)C(F)(F)F)c3c2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H28F6N4O/c1-26(2,3)38-24(19-6-9-20(29)10-7-19)22(17-35-38)25(39)36-21-11-8-18-12-15-37(23(18)16-21)14-5-4-13-27(30,31)28(32,33)34/h6-12,15-17H,4-5,13-14H2,1-3H3,(H,36,39) |
| InChIKey | LHTFNGGQAPGNSJ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.55 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|