C27H29FN4O3 — CID 143452106
5-[6-[[1-tert-butyl-5-(4-fluorophenyl)pyrazole-4-carbonyl]amino]indol-1-yl]pentanoic acid (PubChem CID 143452106) has the molecular formula C27H29FN4O3 and a molecular weight of 476.55 g/mol. Its IUPAC name is 5-[6-[[1-tert-butyl-5-(4-fluorophenyl)pyrazole-4-carbonyl]amino]indol-1-yl]pentanoic acid.
| Compound Name | 5-[6-[[1-tert-butyl-5-(4-fluorophenyl)pyrazole-4-carbonyl]amino]indol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 143452106 |
| Molecular Formula | C27H29FN4O3 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 5-[6-[[1-tert-butyl-5-(4-fluorophenyl)pyrazole-4-carbonyl]amino]indol-1-yl]pentanoic acid |
| SMILES | CC(C)(C)n1ncc(C(=O)Nc2ccc3ccn(CCCCC(=O)O)c3c2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H29FN4O3/c1-27(2,3)32-25(19-7-10-20(28)11-8-19)22(17-29-32)26(35)30-21-12-9-18-13-15-31(23(18)16-21)14-5-4-6-24(33)34/h7-13,15-17H,4-6,14H2,1-3H3,(H,30,35)(H,33,34) |
| InChIKey | OFQWFQUEORIYDH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|