C38H50ClFN4O2 — CID 143451904
1-tert-butyl-N-[4-chloro-3-[[(4E,6Z,8E)-3,4-dimethyldeca-4,6,8-trienyl]-propylcarbamoyl]phenyl]-5-(4-fluorophenyl)pyrazole-4-carboxamide;ethane (PubChem CID 143451904) has the molecular formula C38H50ClFN4O2 and a molecular weight of 649.30 g/mol. Its IUPAC name is 1-tert-butyl-N-[4-chloro-3-[[(4E,6Z,8E)-3,4-dimethyldeca-4,6,8-trienyl]-propylcarbamoyl]phenyl]-5-(4-fluorophenyl)pyrazole-4-carboxamide;ethane.
| Compound Name | 1-tert-butyl-N-[4-chloro-3-[[(4E,6Z,8E)-3,4-dimethyldeca-4,6,8-trienyl]-propylcarbamoyl]phenyl]-5-(4-fluorophenyl)pyrazole-4-carboxamide;ethane |
|---|---|
| PubChem CID | 143451904 |
| Molecular Formula | C38H50ClFN4O2 |
| Molecular Weight | 649.30 g/mol |
| Exact Mass | 648.36 |
| IUPAC Name | 1-tert-butyl-N-[4-chloro-3-[[(4E,6Z,8E)-3,4-dimethyldeca-4,6,8-trienyl]-propylcarbamoyl]phenyl]-5-(4-fluorophenyl)pyrazole-4-carboxamide;ethane |
| SMILES | C/C=C/C=C\C=C(/C)C(C)CCN(CCC)C(=O)c1cc(NC(=O)c2cnn(C(C)(C)C)c2-c2ccc(F)cc2)ccc1Cl.CC |
| InChI | InChI=1S/C36H44ClFN4O2.C2H6/c1-8-10-11-12-13-25(3)26(4)20-22-41(21-9-2)35(44)30-23-29(18-19-32(30)37)40-34(43)31-24-39-42(36(5,6)7)33(31)27-14-16-28(38)17-15-27;1-2/h8,10-19,23-24,26H,9,20-22H2,1-7H3,(H,40,43);1-2H3/b10-8+,12-11-,25-13+; |
| InChIKey | UEAKQCNCBYDKHS-BOIOKQCYSA-N |
| XLogP | 10.33 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.30 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|