C21H24BrN3O3 — CID 59574768
3-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]benzoic acid (PubChem CID 59574768) has the molecular formula C21H24BrN3O3 and a molecular weight of 446.35 g/mol. Its IUPAC name is 3-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]benzoic acid.
| Compound Name | 3-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 59574768 |
| Molecular Formula | C21H24BrN3O3 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 3-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]benzoic acid |
| SMILES | C[C@H]1[C@H](Nc2cnn(-c3cccc(C(=O)O)c3)c(=O)c2Br)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C21H24BrN3O3/c1-11-15-8-13(21(15,2)3)9-16(11)24-17-10-23-25(19(26)18(17)22)14-6-4-5-12(7-14)20(27)28/h4-7,10-11,13,15-16,24H,8-9H2,1-3H3,(H,27,28)/t11-,13-,15+,16-/m1/s1 |
| InChIKey | HXEJJOCZPPHGLO-XABYNWHXSA-N |
| XLogP | 4.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |