C22H27BrN4O3 — CID 89010454
2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-phenoxyacetamide (PubChem CID 89010454) has the molecular formula C22H27BrN4O3 and a molecular weight of 475.39 g/mol. Its IUPAC name is 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-phenoxyacetamide.
| Compound Name | 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-phenoxyacetamide |
|---|---|
| PubChem CID | 89010454 |
| Molecular Formula | C22H27BrN4O3 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-phenoxyacetamide |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1cnn(CC(=O)NOc3ccccc3)c(=O)c1Br)C2(C)C |
| InChI | InChI=1S/C22H27BrN4O3/c1-13-16-9-14(22(16,2)3)10-17(13)25-18-11-24-27(21(29)20(18)23)12-19(28)26-30-15-7-5-4-6-8-15/h4-8,11,13-14,16-17,25H,9-10,12H2,1-3H3,(H,26,28)/t13-,14+,16-,17-/m1/s1 |
| InChIKey | QZETUUFZQKNKKB-YALNPMBYSA-N |
| XLogP | 3.60 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|