C22H29BrN4O2S — CID 70823331
2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(5-methylthiophen-2-yl)methyl]acetamide (PubChem CID 70823331) has the molecular formula C22H29BrN4O2S and a molecular weight of 493.47 g/mol. Its IUPAC name is 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(5-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 70823331 |
| Molecular Formula | C22H29BrN4O2S |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)Cn2ncc(N[C@@H]3C[C@@H]4C[C@H]([C@H]3C)C4(C)C)c(Br)c2=O)s1 |
| InChI | InChI=1S/C22H29BrN4O2S/c1-12-5-6-15(30-12)9-24-19(28)11-27-21(29)20(23)18(10-25-27)26-17-8-14-7-16(13(17)2)22(14,3)4/h5-6,10,13-14,16-17,26H,7-9,11H2,1-4H3,(H,24,28)/t13-,14+,16-,17-/m1/s1 |
| InChIKey | SAHQCRYPJJZZQO-YALNPMBYSA-N |
| XLogP | 4.17 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |