C23H30BrN5O2 — CID 59574456
4-bromo-2-[4-(5-methylpyrazin-2-yl)-2-oxobutyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 59574456) has the molecular formula C23H30BrN5O2 and a molecular weight of 488.43 g/mol. Its IUPAC name is 4-bromo-2-[4-(5-methylpyrazin-2-yl)-2-oxobutyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-[4-(5-methylpyrazin-2-yl)-2-oxobutyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 59574456 |
| Molecular Formula | C23H30BrN5O2 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 4-bromo-2-[4-(5-methylpyrazin-2-yl)-2-oxobutyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | Cc1cnc(CCC(=O)Cn2ncc(N[C@@H]3C[C@H]4C[C@@H]([C@H]3C)C4(C)C)c(Br)c2=O)cn1 |
| InChI | InChI=1S/C23H30BrN5O2/c1-13-9-26-16(10-25-13)5-6-17(30)12-29-22(31)21(24)20(11-27-29)28-19-8-15-7-18(14(19)2)23(15,3)4/h9-11,14-15,18-19,28H,5-8,12H2,1-4H3/t14-,15-,18+,19-/m1/s1 |
| InChIKey | KRFNAISROIWESK-VVWQDTPRSA-N |
| XLogP | 3.79 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |