C21H27BrN6O2 — CID 70830878
2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(pyrazin-2-ylmethyl)acetamide (PubChem CID 70830878) has the molecular formula C21H27BrN6O2 and a molecular weight of 475.39 g/mol. Its IUPAC name is 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(pyrazin-2-ylmethyl)acetamide.
| Compound Name | 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(pyrazin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 70830878 |
| Molecular Formula | C21H27BrN6O2 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(pyrazin-2-ylmethyl)acetamide |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1cnn(CC(=O)NCc3cnccn3)c(=O)c1Br)C2(C)C |
| InChI | InChI=1S/C21H27BrN6O2/c1-12-15-6-13(21(15,2)3)7-16(12)27-17-10-26-28(20(30)19(17)22)11-18(29)25-9-14-8-23-4-5-24-14/h4-5,8,10,12-13,15-16,27H,6-7,9,11H2,1-3H3,(H,25,29)/t12-,13+,15-,16-/m1/s1 |
| InChIKey | JGZLEBYGLDFCOJ-OCVGTWLNSA-N |
| XLogP | 2.59 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |