C20H28BrN3O2 — CID 91551230
4-bromo-2-(3-cyclopropyl-2-oxopropyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 91551230) has the molecular formula C20H28BrN3O2 and a molecular weight of 422.37 g/mol. Its IUPAC name is 4-bromo-2-(3-cyclopropyl-2-oxopropyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(3-cyclopropyl-2-oxopropyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 91551230 |
| Molecular Formula | C20H28BrN3O2 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 4-bromo-2-(3-cyclopropyl-2-oxopropyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1cnn(CC(=O)CC3CC3)c(=O)c1Br)C2(C)C |
| InChI | InChI=1S/C20H28BrN3O2/c1-11-15-7-13(20(15,2)3)8-16(11)23-17-9-22-24(19(26)18(17)21)10-14(25)6-12-4-5-12/h9,11-13,15-16,23H,4-8,10H2,1-3H3/t11-,13+,15-,16-/m1/s1 |
| InChIKey | SSDICKNYESIDPD-WXYCVUISSA-N |
| XLogP | 3.86 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |