C23H29BrN4O2 — CID 59574203
4-bromo-2-(2-oxo-4-pyridin-4-ylbutyl)-5-[[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 59574203) has the molecular formula C23H29BrN4O2 and a molecular weight of 473.42 g/mol. Its IUPAC name is 4-bromo-2-(2-oxo-4-pyridin-4-ylbutyl)-5-[[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(2-oxo-4-pyridin-4-ylbutyl)-5-[[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 59574203 |
| Molecular Formula | C23H29BrN4O2 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 4-bromo-2-(2-oxo-4-pyridin-4-ylbutyl)-5-[[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | C[C@@H]1[C@@H](Nc2cnn(CC(=O)CCc3ccncc3)c(=O)c2Br)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C23H29BrN4O2/c1-14-18-10-16(23(18,2)3)11-19(14)27-20-12-26-28(22(30)21(20)24)13-17(29)5-4-15-6-8-25-9-7-15/h6-9,12,14,16,18-19,27H,4-5,10-11,13H2,1-3H3/t14-,16-,18+,19-/m0/s1 |
| InChIKey | HHCCYSNZOSBXAK-WQCNXYOZSA-N |
| XLogP | 4.09 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |