C23H31BrN4O — CID 59574438
4-bromo-2-(4-pyridin-4-ylbutyl)-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 59574438) has the molecular formula C23H31BrN4O and a molecular weight of 459.43 g/mol. Its IUPAC name is 4-bromo-2-(4-pyridin-4-ylbutyl)-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(4-pyridin-4-ylbutyl)-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 59574438 |
| Molecular Formula | C23H31BrN4O |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 4-bromo-2-(4-pyridin-4-ylbutyl)-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | C[C@H]1[C@H](Nc2cnn(CCCCc3ccncc3)c(=O)c2Br)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C23H31BrN4O/c1-15-18-12-17(23(18,2)3)13-19(15)27-20-14-26-28(22(29)21(20)24)11-5-4-6-16-7-9-25-10-8-16/h7-10,14-15,17-19,27H,4-6,11-13H2,1-3H3/t15-,17-,18+,19-/m1/s1 |
| InChIKey | ZGIFYKWRXVFYLU-OQIJWPOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|