C24H33N5O2S — CID 143799908
2-[5-ethylsulfanyl-6-oxo-4-[[(1R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 143799908) has the molecular formula C24H33N5O2S and a molecular weight of 455.63 g/mol. Its IUPAC name is 2-[5-ethylsulfanyl-6-oxo-4-[[(1R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-[5-ethylsulfanyl-6-oxo-4-[[(1R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 143799908 |
| Molecular Formula | C24H33N5O2S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 2-[5-ethylsulfanyl-6-oxo-4-[[(1R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | CCSc1c(N[C@@H]2C[C@@H]3C[C@H](C2C)C3(C)C)cnn(CC(=O)NCc2ccncc2)c1=O |
| InChI | InChI=1S/C24H33N5O2S/c1-5-32-22-20(28-19-11-17-10-18(15(19)2)24(17,3)4)13-27-29(23(22)31)14-21(30)26-12-16-6-8-25-9-7-16/h6-9,13,15,17-19,28H,5,10-12,14H2,1-4H3,(H,26,30)/t15?,17-,18+,19+/m0/s1 |
| InChIKey | AOGYEPWLAQMBRS-GZWWCELFSA-N |
| XLogP | 3.55 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |